1072945-75-5 Usage
Uses
Used in Medicinal Chemistry:
6-Bromo-4-methylpyridine-3-boronic acid is utilized as a key intermediate in the synthesis of various pharmaceutical compounds. Its ability to form stable complexes with diols makes it a valuable component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Drug Discovery:
In the field of drug discovery, 6-Bromo-4-methylpyridine-3-boronic acid serves as a versatile building block for the creation of novel drug candidates. Its unique structure and reactivity contribute to the design of molecules with potential therapeutic applications.
Used in Agrochemical Development:
6-Bromo-4-methylpyridine-3-boronic acid is employed as a starting material in the synthesis of agrochemicals, such as pesticides and herbicides. Its chemical properties allow for the development of compounds that can effectively control pests and weeds in agricultural settings.
Used in Materials Science:
In materials science, 6-Bromo-4-methylpyridine-3-boronic acid is used to develop new materials with specific properties. Its incorporation into polymers or other materials can lead to the creation of substances with tailored characteristics for various applications.
Used as a Catalyst in Organic Synthesis:
6-Bromo-4-methylpyridine-3-boronic acid is used as a catalyst in a variety of organic reactions. Its ability to form stable complexes with diols makes it an effective catalyst for processes such as Suzuki-Miyaura cross-coupling reactions, which are widely used in the synthesis of biologically active compounds and natural products.
Used in the Synthesis of Complex Organic Molecules:
6-Bromo-4-methylpyridine-3-boronic acid is a valuable reagent in the synthesis of complex organic molecules. Its unique structure and reactivity make it an essential component in the construction of intricate molecular architectures, which are often found in natural products and pharmaceutical agents.
Check Digit Verification of cas no
The CAS Registry Mumber 1072945-75-5 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,7,2,9,4 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1072945-75:
(9*1)+(8*0)+(7*7)+(6*2)+(5*9)+(4*4)+(3*5)+(2*7)+(1*5)=165
165 % 10 = 5
So 1072945-75-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BBrNO2/c1-4-2-6(8)9-3-5(4)7(10)11/h2-3,10-11H,1H3
