1072945-75-5 Usage
General Description
6-Bromo-4-methylpyridine-3-boronic acid is a chemical compound with the formula C6H7BrNO2. It is a boronic acid derivative with a pyridine ring substituted with bromine and a methyl group. 6-Bromo-4-methylpyridine-3-boronic acid is a versatile building block in organic synthesis, particularly in the field of medicinal chemistry and drug discovery. Boronic acids are known for their ability to form stable complexes with diols and are commonly used as catalysts in a variety of chemical reactions. 6-Bromo-4-methylpyridine-3-boronic acid has potential applications in the development of pharmaceuticals, agrochemicals, and materials science. Additionally, it can serve as a valuable reagent in the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 1072945-75-5 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,7,2,9,4 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1072945-75:
(9*1)+(8*0)+(7*7)+(6*2)+(5*9)+(4*4)+(3*5)+(2*7)+(1*5)=165
165 % 10 = 5
So 1072945-75-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BBrNO2/c1-4-2-6(8)9-3-5(4)7(10)11/h2-3,10-11H,1H3