1072952-12-5 Usage
General Description
2,4-Dichloro-5-nitrophenylboronic acid is a chemical compound with the molecular formula C6H4BCl2NO4. It is a boronic acid derivative with two chlorine atoms and a nitro group attached to a phenyl ring. 2,4-Dichloro-5-nitrophenylboronic acid is commonly used in organic synthesis as a building block for the preparation of various pharmaceuticals and agrochemicals. It is also used as a ligand in metal-catalyzed cross-coupling reactions. 2,4-Dichloro-5-nitrophenylboronic acid is known for its ability to form stable complexes with various transition metals, making it a valuable tool in modern chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 1072952-12-5 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,7,2,9,5 and 2 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1072952-12:
(9*1)+(8*0)+(7*7)+(6*2)+(5*9)+(4*5)+(3*2)+(2*1)+(1*2)=145
145 % 10 = 5
So 1072952-12-5 is a valid CAS Registry Number.
InChI:InChI=1S/C6H4BCl2NO4/c8-4-2-5(9)6(10(13)14)1-3(4)7(11)12/h1-2,11-12H