1073-54-7 Usage
General Description
2-Pyrimidinamine, 4-(methylthio)- (9CI) is a chemical compound with the molecular formula C5H6N2S. It is a pyrimidine derivative with a methylthio group attached to the fourth position of the pyrimidine ring. This chemical is used in pharmaceutical research and development, particularly in the synthesis of pharmaceutical compounds and organic molecules. It has also been studied for its potential biological activities, such as its antimicrobial and antitumor properties. Additionally, 2-Pyrimidinamine, 4-(methylthio)- (9CI) may have applications in the production of agrochemicals, dyes, and other fine chemicals due to its unique structure and reactivity. Overall, this chemical compound has potential uses in various industries and fields of scientific research.
Check Digit Verification of cas no
The CAS Registry Mumber 1073-54-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,7 and 3 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1073-54:
(6*1)+(5*0)+(4*7)+(3*3)+(2*5)+(1*4)=57
57 % 10 = 7
So 1073-54-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3S/c1-9-4-2-3-7-5(6)8-4/h2-3H,1H3,(H2,6,7,8)
