107346-32-7 Usage
Uses
Given the lack of explicit uses in the provided materials, the following applications are speculative based on the compound's class and structure:
Used in Pharmaceutical Industry:
4-AMINO-8-BROMO-N-PROPYL-DAZINE-3-AMIDE could be used as a pharmaceutical intermediate for the development of new drugs, given its structural features that may allow for interactions with biological targets. Its potential use in this industry would be driven by the need to explore novel compounds for therapeutic applications.
Used in Medicinal Chemistry Research:
As a dazine derivative, 4-AMINO-8-BROMO-N-PROPYL-DAZINE-3-AMIDE might be utilized in medicinal chemistry research to study its binding affinity, selectivity, and mechanism of action on various biological targets, contributing to the discovery of new lead compounds or drug candidates.
Used in Chemical Synthesis:
4-AMINO-8-BROMO-N-PROPYL-DAZINE-3-AMIDE could serve as a building block or reactant in the synthesis of more complex molecules with potential applications in various fields, including materials science, agrochemicals, or specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 107346-32-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,3,4 and 6 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 107346-32:
(8*1)+(7*0)+(6*7)+(5*3)+(4*4)+(3*6)+(2*3)+(1*2)=107
107 % 10 = 7
So 107346-32-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H13BrN4O/c1-2-6-15-12(18)11-9(14)7-4-3-5-8(13)10(7)16-17-11/h3-5H,2,6H2,1H3,(H2,14,16)(H,15,18)
