107363-01-9 Usage
Uses
Used in Pharmaceutical Development:
3-(1H-Pyrrol-1-yl)-1-benzothiophene-2-carbohydrazide is used as a chemical intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and properties make it a valuable component in the development of new drugs, particularly in the field of medicinal chemistry.
Used in Academic Research:
3-(1H-PYRROL-1-YL)-1-BENZOTHIOPHENE-2-CARBOHYDRAZIDE is also used in academic studies, where researchers explore its chemical properties, potential applications, and interactions with other molecules. The study of benzothiophenes like 3-(1H-Pyrrol-1-yl)-1-benzothiophene-2-carbohydrazide can contribute to the understanding of chemical reactions and the design of new molecules with specific functions.
Used in Industrial Applications:
3-(1H-Pyrrol-1-yl)-1-benzothiophene-2-carbohydrazide finds use in various industrial applications, where its chemical properties are harnessed for the production of different products. The versatility of benzothiophenes makes them suitable for a wide range of uses, from the synthesis of specialty chemicals to the development of advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 107363-01-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,3,6 and 3 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 107363-01:
(8*1)+(7*0)+(6*7)+(5*3)+(4*6)+(3*3)+(2*0)+(1*1)=99
99 % 10 = 9
So 107363-01-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H11N3OS/c14-15-13(17)12-11(16-7-3-4-8-16)9-5-1-2-6-10(9)18-12/h1-8H,14H2,(H,15,17)
