107419-49-8 Usage
General Description
2-(4-Hydroxyphenyl)-3-methyl-4-quinolinecarboxylic acid is a molecule with a chemical structure consisting of a quinoline core with a carboxylic acid group and a hydroxyl group attached to a phenyl ring at position 4. The presence of the hydroxyl group makes it a phenolic compound, and the quinoline core gives it aromatic and heterocyclic properties. This chemical is often used in pharmaceutical research and drug development due to its potential therapeutic properties, particularly as an anti-inflammatory or antimicrobial agent. Its structure and functional groups make it a promising candidate for further study in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 107419-49-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,4,1 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 107419-49:
(8*1)+(7*0)+(6*7)+(5*4)+(4*1)+(3*9)+(2*4)+(1*9)=118
118 % 10 = 8
So 107419-49-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H13NO3/c1-10-15(17(20)21)13-4-2-3-5-14(13)18-16(10)11-6-8-12(19)9-7-11/h2-9,18H,1H3,(H,20,21)/p-1
