107564-21-6 Usage
Core structure
Phenazine ring system A ring structure consisting of two nitrogen atoms at positions 2 and 7, which gives the compound its unique properties.
Substituents
Two methyl groups at positions 3 and 8 These groups contribute to the compound's stability and reactivity.
Heterocyclic aromatic compound
The presence of nitrogen atoms in the ring structure, which imparts unique electronic properties and reactivity compared to purely carbon-based aromatic compounds.
Potential applications
Dye in organic electronics The compound's electronic properties make it suitable for use as a dye in organic electronic devices, such as organic light-emitting diodes (OLEDs) and organic solar cells.
Therapeutic agent
Potential treatment for diseases like cancer The compound's unique structure and properties have been studied for their potential use in treating various diseases, including cancer.
Scientific and industrial interest
Due to its unique structure and properties, 2,7-diamino-3,8-dimethylphenazine is a subject of interest in various scientific and industrial applications, including the development of new materials and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 107564-21-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,5,6 and 4 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 107564-21:
(8*1)+(7*0)+(6*7)+(5*5)+(4*6)+(3*4)+(2*2)+(1*1)=116
116 % 10 = 6
So 107564-21-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H14N4/c1-7-3-11-13(5-9(7)15)18-12-4-8(2)10(16)6-14(12)17-11/h3-6H,15-16H2,1-2H3
