107624-16-8 Usage
Description
6-PHENYL-M-ANISIDINE HYDROCHLORIDE, also known as 3-Methoxybenzaniline hydrochloride, is a chemical compound that serves as a versatile building block in organic synthesis and pharmaceutical research. As a derivative of aniline and anisidine, its hydrochloride form is a water-soluble salt, which enhances its utility in various chemical processes. 6-PHENYL-M-ANISIDINE HYDROCHLORIDE is recognized for its unique structure and properties, making it a promising candidate for the development of novel drugs and chemical processes. However, due to its potential hazards and safety concerns, it must be handled and used with caution.
Uses
Used in Pharmaceutical Research:
6-PHENYL-M-ANISIDINE HYDROCHLORIDE is used as a key intermediate in the synthesis of biologically active molecules for pharmaceutical applications. Its unique structure allows it to be a valuable component in the creation of new drugs, contributing to the advancement of medical treatments.
Used in Organic Synthesis:
In the field of organic synthesis, 6-PHENYL-M-ANISIDINE HYDROCHLORIDE is used as a reactant or catalyst to facilitate the formation of desired chemical products. Its reactivity and solubility properties make it suitable for a wide range of chemical reactions.
Used in Agrochemical Development:
6-PHENYL-M-ANISIDINE HYDROCHLORIDE is utilized as a precursor in the development of agrochemicals, such as pesticides and herbicides. Its role in these applications is to provide the necessary chemical backbone for the creation of effective and targeted agricultural chemicals.
Used in Chemical Process Development:
6-PHENYL-M-ANISIDINE HYDROCHLORIDE is employed as a component in the development of new chemical processes, where its unique properties can be leveraged to improve efficiency, yield, or selectivity in chemical reactions.
Used in Research and Development:
6-PHENYL-M-ANISIDINE HYDROCHLORIDE is used as a research tool in academic and industrial laboratories to explore new chemical reactions, mechanisms, and applications, further expanding the understanding of its potential uses and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 107624-16-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,6,2 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 107624-16:
(8*1)+(7*0)+(6*7)+(5*6)+(4*2)+(3*4)+(2*1)+(1*6)=108
108 % 10 = 8
So 107624-16-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO.ClH/c1-15-11-7-8-12(13(14)9-11)10-5-3-2-4-6-10;/h2-9H,14H2,1H3;1H
