107638-88-0 Usage
General Description
The chemical "2,4-Dinitro-3-phenylpentane dinitrile with 2,2-dichloro-N-(2,2-dichloroethyl)ethanamine" is a combination of two compounds. The first compound, 2,4-dinitro-3-phenylpentane dinitrile, is a nitro compound with two nitro groups attached to a phenylpentane chain. The second compound, 2,2-dichloro-N-(2,2-dichloroethyl)ethanamine, is a dichloroethyl derivative of ethanamine. When these two compounds are combined, they may react with each other to form a new chemical compound with unique properties and potential applications in various industries, including pharmaceuticals, agriculture, and chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 107638-88-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,6,3 and 8 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 107638-88:
(8*1)+(7*0)+(6*7)+(5*6)+(4*3)+(3*8)+(2*8)+(1*8)=140
140 % 10 = 0
So 107638-88-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N4O4.C4H7Cl4N/c12-6-9(14(16)17)11(10(7-13)15(18)19)8-4-2-1-3-5-8;5-3(6)1-9-2-4(7)8/h1-5,9-11H;3-4,9H,1-2H2