107904-06-3 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl morpholine-2-carboxylate is used as a key intermediate in the synthesis of medicinal drugs for its ability to contribute to the formation of complex molecular structures that can target specific biological pathways.
Used in Pesticide Production:
In the agrochemical sector, ethyl morpholine-2-carboxylate is utilized as an intermediate in the production of pesticides, playing a crucial role in creating compounds that can effectively control pests while ensuring safety and environmental sustainability.
Used in Organic Compounds Synthesis:
Ethyl morpholine-2-carboxylate is employed as a building block in the synthesis of various organic compounds, contributing to the development of new materials and chemicals with a wide range of applications.
Used in Research and Development:
In the scientific community, ethyl morpholine-2-carboxylate is used as a component in research and development efforts to explore its potential in creating new compounds with therapeutic properties, further expanding its utility in the pharmaceutical and chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 107904-06-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,9,0 and 4 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 107904-06:
(8*1)+(7*0)+(6*7)+(5*9)+(4*0)+(3*4)+(2*0)+(1*6)=113
113 % 10 = 3
So 107904-06-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H13NO3/c1-2-10-7(9)6-5-8-3-4-11-6/h6,8H,2-5H2,1H3
