1080-52-0 Usage
Uses
Used in Pharmaceutical Research:
1-(2,4-DIMETHYL-PHENYL)-PYRROLE-2,5-DIONE is used as a research compound for its potential anti-cancer properties. It has been studied for its ability to target and inhibit specific cancer-related pathways, making it a promising candidate for the development of new cancer therapies.
1-(2,4-DIMETHYL-PHENYL)-PYRROLE-2,5-DIONE is also used as an anti-inflammatory agent. Its potential to modulate inflammatory responses could lead to the development of new treatments for various inflammatory conditions.
Used in Organic Synthesis:
In the field of organic synthesis, 1-(2,4-DIMETHYL-PHENYL)-PYRROLE-2,5-DIONE serves as a key intermediate or building block for the synthesis of more complex organic molecules. Its unique structure allows for further functionalization and modification, enabling the creation of novel compounds with diverse applications.
Used in Protein-Protein Interaction Inhibition:
1-(2,4-DIMETHYL-PHENYL)-PYRROLE-2,5-DIONE is used as a potential inhibitor of protein-protein interactions. Its ability to disrupt specific protein interactions could have implications in the development of targeted therapies for various diseases, including cancer and inflammatory disorders.
Overall, 1-(2,4-DIMETHYL-PHENYL)-PYRROLE-2,5-DIONE is a versatile chemical compound with a wide range of potential applications in pharmaceutical research, organic synthesis, and the development of novel therapeutic agents. Its unique structure and promising biological activities make it an interesting target for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 1080-52-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,8 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1080-52:
(6*1)+(5*0)+(4*8)+(3*0)+(2*5)+(1*2)=50
50 % 10 = 0
So 1080-52-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H11NO2/c1-8-3-4-10(9(2)7-8)13-11(14)5-6-12(13)15/h3-7H,1-2H3
1080-52-0Relevant academic research and scientific papers
Aerobic Oxidative EDA Catalysis: Synthesis of Tetrahydroquinolines Using an Organocatalytic EDA Active Acceptor
Runemark, August,Sundén, Henrik
, p. 1457 - 1469 (2022/02/07)
A catalytic electron donor-acceptor (EDA) complex for the visible-light-driven annulation reaction between activated alkenes and N,N-substituted dialkyl anilines is reported. The key photoactive complex is formed in situ between dialkylated anilines as do
