1080-52-0 Usage
General Description
1-(2,4-DIMETHYL-PHENYL)-PYRROLE-2,5-DIONE is a chemical compound with the molecular formula C12H11NO2. It is a pyrrole-2,5-dione derivative with a 2,4-dimethylphenyl substituent. 1-(2,4-DIMETHYL-PHENYL)-PYRROLE-2,5-DIONE is often used in organic synthesis and pharmaceutical research due to its potential biological activities. It has been studied for its potential as an anti-cancer and anti-inflammatory agent, and as a potential inhibitor of protein-protein interactions. Its unique structure and potential pharmacological properties make it an interesting target for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 1080-52-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,8 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1080-52:
(6*1)+(5*0)+(4*8)+(3*0)+(2*5)+(1*2)=50
50 % 10 = 0
So 1080-52-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H11NO2/c1-8-3-4-10(9(2)7-8)13-11(14)5-6-12(13)15/h3-7H,1-2H3
1080-52-0Relevant articles and documents
Aerobic Oxidative EDA Catalysis: Synthesis of Tetrahydroquinolines Using an Organocatalytic EDA Active Acceptor
Runemark, August,Sundén, Henrik
, p. 1457 - 1469 (2022/02/07)
A catalytic electron donor-acceptor (EDA) complex for the visible-light-driven annulation reaction between activated alkenes and N,N-substituted dialkyl anilines is reported. The key photoactive complex is formed in situ between dialkylated anilines as do