108051-28-1 Usage
General Description
The chemical compound "(E)-1-(5-acetyl-2,4-dihydroxy-phenyl)-3-(4-hydroxy-3-methoxy-phenyl)prop-2-en-1-one" is a type of chalcone, a class of organic compounds with potential pharmaceutical and medicinal properties. It contains a combination of acetyl, hydroxy, and methoxy functional groups attached to a central aromatic ring structure. These functional groups contribute to its antioxidant, anti-inflammatory, and potential anti-cancer properties. Additionally, its chemical structure suggests that it may have the ability to interact with enzymes and receptors in the body, making it a promising candidate for further research and development in the pharmaceutical and medical fields.
Check Digit Verification of cas no
The CAS Registry Mumber 108051-28-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,0,5 and 1 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 108051-28:
(8*1)+(7*0)+(6*8)+(5*0)+(4*5)+(3*1)+(2*2)+(1*8)=91
91 % 10 = 1
So 108051-28-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H16O6/c1-10(19)12-8-13(17(23)9-16(12)22)14(20)5-3-11-4-6-15(21)18(7-11)24-2/h3-9,21-23H,1-2H3/b5-3+