108097-02-5 Usage
General Description
2-Methyl-4,7,8-trichloroquinoline is a chemical compound with the molecular formula C10H6Cl3N. It is a trichloroquinoline derivative and is a pale yellow crystalline solid. 2-METHYL-4,7,8-TRICHLOROQUINOLINE is used in the pharmaceutical industry as a building block for the synthesis of various drugs and pharmaceuticals. Its structure and properties make it useful for its potential pharmacological and biological activities, and it has been studied for its antimicrobial, antifungal, and antiviral properties. Additionally, it has been investigated for its potential use as an antiparasitic agent. However, further research is warranted to fully understand and harness its potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 108097-02-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,0,9 and 7 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 108097-02:
(8*1)+(7*0)+(6*8)+(5*0)+(4*9)+(3*7)+(2*0)+(1*2)=115
115 % 10 = 5
So 108097-02-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H6Cl3N/c1-5-4-8(12)6-2-3-7(11)9(13)10(6)14-5/h2-4H,1H3
