108097-04-7 Usage
General Description
2-CHLORO-3,8-DIMETHYLQUINOLINE is a chemical compound with the molecular formula C11H11ClN. It is a chlorinated quinoline derivative with two methyl groups attached to the quinoline ring. 2-CHLORO-3,8-DIMETHYLQUINOLINE is commonly used as a building block in the synthesis of various pharmaceuticals and agrochemicals. Its unique structure and properties make it a valuable intermediate in organic synthesis, where it can be used in the preparation of diverse range of compounds. Additionally, 2-CHLORO-3,8-DIMETHYLQUINOLINE has potential applications in the field of medicinal chemistry and drug development, due to its ability to interact with biological targets and exhibit pharmacological activity. Overall, this chemical compound plays a significant role in the development of novel drugs and other valuable chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 108097-04-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,0,9 and 7 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 108097-04:
(8*1)+(7*0)+(6*8)+(5*0)+(4*9)+(3*7)+(2*0)+(1*4)=117
117 % 10 = 7
So 108097-04-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H10ClN/c1-7-4-3-5-9-6-8(2)11(12)13-10(7)9/h3-6H,1-2H3
