108249-93-0 Usage
Uses
Used in Pharmaceutical Industry:
2,8-Dichlorocyclooctanone is used as a precursor in the synthesis of various pharmaceuticals for its ability to be chemically modified and incorporated into the structure of different medicinal compounds.
Used in Agrochemical Industry:
In the agrochemical sector, 2,8-Dichlorocyclooctanone is utilized as a starting material for the production of various agrochemicals, contributing to the development of pesticides and other agricultural products.
Used in Material Science:
2,8-Dichlorocyclooctanone is employed in the creation of new materials, where its unique chemical properties allow for the development of innovative substances with potential applications in various industries.
Used in Research and Development:
2,8-DICHLOROCYCLOOCTANONE is used as a research tool in the development of new chemical compounds, enabling scientists to explore its reactivity and potential applications in advancing chemical knowledge and technology.
Check Digit Verification of cas no
The CAS Registry Mumber 108249-93-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,2,4 and 9 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 108249-93:
(8*1)+(7*0)+(6*8)+(5*2)+(4*4)+(3*9)+(2*9)+(1*3)=130
130 % 10 = 0
So 108249-93-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H12Cl2O/c9-6-4-2-1-3-5-7(10)8(6)11/h6-7H,1-5H2
