108274-38-0 Usage
Description
Ethyl 2-(4-Chloro-2-nitrophenyl)acetate is a chemical compound with the molecular formula C10H10ClNO4. It is an ester, containing a nitrophenyl group and a chloro substituent attached to an acetate functional group. Ethyl 2-(4-Chloro-2-nitrophenyl)acetate is known for its versatile applications in various industries, particularly in the synthesis of pharmaceuticals and agrochemicals, as well as in organic reactions and the production of fragrances. Due to its potential health and environmental hazards, it is crucial to handle this compound with care.
Uses
Used in Pharmaceutical Industry:
Ethyl 2-(4-Chloro-2-nitrophenyl)acetate is used as an intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the formation of complex molecular structures. Its presence in the synthesis process aids in creating a wide range of medicinal compounds that address different health conditions.
Used in Agrochemical Industry:
In the agrochemical sector, Ethyl 2-(4-Chloro-2-nitrophenyl)acetate is utilized as a precursor in the production of pesticides and other agrochemicals. Its role in these applications is to provide a stable and effective base for the development of compounds that protect crops and enhance agricultural productivity.
Used in Organic Reactions:
Ethyl 2-(4-Chloro-2-nitrophenyl)acetate is employed as a reactant in various organic reactions, where it serves as a key component in the formation of new chemical entities. Its unique structure allows it to participate in a range of reactions, contributing to the synthesis of diverse organic compounds.
Used in Fragrance Production:
In the fragrance industry, Ethyl 2-(4-Chloro-2-nitrophenyl)acetate is used as a building block for creating complex and unique scents. Its chemical properties enable it to be incorporated into the composition of fragrances, adding depth and character to the final product.
Check Digit Verification of cas no
The CAS Registry Mumber 108274-38-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,2,7 and 4 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 108274-38:
(8*1)+(7*0)+(6*8)+(5*2)+(4*7)+(3*4)+(2*3)+(1*8)=120
120 % 10 = 0
So 108274-38-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H10ClNO5/c1-2-16-10(13)6-17-9-4-3-7(11)5-8(9)12(14)15/h3-5H,2,6H2,1H3
108274-38-0Relevant articles and documents
1,2-disubstituted-6-oxo-3-phenyl-piperidine-3-carboxamides and combinatorial libraries thereof
-
, (2008/06/13)
The invention relates to combinatorial libraries containing two or more novel piperidine-3-carboxamide derivative compounds, methods of preparing the piperidine-3-carboxamide derivative compounds and piperidine-3-carboxamide derivative compounds bound to a resin