108330-39-8 Usage
General Description
3-Mercapto-3,3-cyclopentamethylenepropionic acid, also known as thiomethylpentacyclopentamethylenepropionate, is a chemical compound with the molecular formula C10H18O2S. It contains a thiol group and a carboxylic acid group, making it a bifunctional molecule with potential applications in various chemical processes. 3-mercapto-3,3-cyclopentamethylenepropionic acid is commonly used as a chain transfer agent in polymerization reactions, as well as a stabilizer for polymers and other materials. It is also utilized in the synthesis of pharmaceuticals and other organic compounds. Due to its unique structure and functional groups, 3-mercapto-3,3-cyclopentamethylenepropionic acid has attracted interest for its potential applications in various fields of chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 108330-39-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,3,3 and 0 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 108330-39:
(8*1)+(7*0)+(6*8)+(5*3)+(4*3)+(3*0)+(2*3)+(1*9)=98
98 % 10 = 8
So 108330-39-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O2S/c9-7(10)6-8(11)4-2-1-3-5-8/h11H,1-6H2,(H,9,10)