108372-48-1 Usage
Uses
Used in Chemical Synthesis:
5-(2-Thienyl)tetrahydrothiophen-3-one is used as an intermediate in the synthesis of organic compounds for various applications. Its unique structure allows it to participate in a range of chemical reactions, contributing to the formation of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 5-(2-Thienyl)tetrahydrothiophen-3-one serves as a building block for the preparation of pharmaceuticals. Its aromatic and sulfur-containing characteristics make it a valuable component in the development of new drugs, potentially enhancing their efficacy and selectivity.
Used in Agrochemicals:
5-(2-Thienyl)tetrahydrothiophen-3-one is also utilized in the agrochemical industry, where it acts as a precursor in the synthesis of various agrochemicals. Its properties can be harnessed to create compounds that are effective in agricultural applications, such as pest control and crop protection.
Overall, 5-(2-Thienyl)tetrahydrothiophen-3-one's diverse applications across different industries highlight its importance as a versatile chemical compound with potential for further development and innovation in chemical and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 108372-48-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,3,7 and 2 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 108372-48:
(8*1)+(7*0)+(6*8)+(5*3)+(4*7)+(3*2)+(2*4)+(1*8)=121
121 % 10 = 1
So 108372-48-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H8OS2/c9-6-4-8(11-5-6)7-2-1-3-10-7/h1-3,8H,4-5H2