1084-43-1 Usage
Uses
Used in Chemistry Experiments:
1,3-diamino-5-methylphenazinium chloride is used as a redox indicator for detecting changes in the oxidation state of substances in a solution, which is crucial for understanding chemical reactions and their outcomes.
Used in Analytical and Biochemical Studies:
In these fields, 1,3-diamino-5-methylphenazinium chloride is used as a detection agent for identifying the presence of specific substances within a solution, contributing to the accuracy and reliability of experimental results.
Used in Photodynamic Therapy Research:
1,3-diamino-5-methylphenazinium chloride is being investigated for its potential use as a photosensitizer in photodynamic therapy for cancer treatment. Its capability to generate cytotoxic singlet oxygen upon exposure to specific light wavelengths makes it a candidate for further research into its safety and efficacy in medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1084-43-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,8 and 4 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1084-43:
(6*1)+(5*0)+(4*8)+(3*4)+(2*4)+(1*3)=61
61 % 10 = 1
So 1084-43-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N4/c1-17-11-5-3-2-4-10(11)16-13-9(15)6-8(14)7-12(13)17/h2-7,9H,14-15H2,1H3
