1087-33-8 Usage
Uses
Used in Dye and Pigment Production:
s-Triazine, 2-amino-4-(p-(propylthio)anilino)is used as a key intermediate in the synthesis of dyes and pigments, contributing to their color properties and stability. Its unique chemical structure allows for the creation of a wide range of colors and hues, making it valuable in the textile, printing, and painting industries.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, s-Triazine, 2-amino-4-(p-(propylthio)anilino)serves as a building block for the development of various drugs. Its chemical properties enable the design of novel therapeutic agents with potential applications in treating different medical conditions.
Used in Herbicide Formulation:
s-Triazine, 2-amino-4-(p-(propylthio)anilino)has been studied for its potential use as a herbicide, demonstrating its ability to control the growth of unwanted plants. Its incorporation into herbicide formulations can provide effective weed control, benefiting agriculture and horticulture.
Used in Medical Treatments:
s-Triazine, 2-amino-4-(p-(propylthio)anilino)has also been explored for its potential applications in the treatment of certain medical conditions. Its unique chemical structure allows for the development of targeted therapies, offering new avenues for medical research and treatment options.
Check Digit Verification of cas no
The CAS Registry Mumber 1087-33-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,8 and 7 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1087-33:
(6*1)+(5*0)+(4*8)+(3*7)+(2*3)+(1*3)=68
68 % 10 = 8
So 1087-33-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N5S/c1-2-7-18-10-5-3-9(4-6-10)16-12-15-8-14-11(13)17-12/h3-6,8H,2,7H2,1H3,(H3,13,14,15,16,17)
