108847-76-3 Usage
Uses
Used in Pharmaceutical Industry:
THIANTHRENE-1-BORONIC ACID is used as a reactant for Pd2+ and Cu2+ catalyzed oxidative cross-couplings, which are essential for the preparation of biologically and pharmacologically active molecules. These cross-coupling reactions enable the formation of new carbon-carbon bonds, facilitating the synthesis of complex organic molecules with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, THIANTHRENE-1-BORONIC ACID serves as a versatile intermediate for the construction of various organic compounds. Its reactivity with different catalysts allows for the formation of a wide range of products, making it a valuable tool for chemists working on the development of new materials and compounds.
Used in Suzuki-Miyaura Cross-Coupling Reactions:
THIANTHRENE-1-BORONIC ACID is also used in Suzuki-Miyaura cross-coupling reactions, a widely employed method for the formation of carbon-carbon bonds. This reaction is particularly useful for the synthesis of biologically active molecules and the development of new pharmaceutical agents, as it allows for the efficient and selective formation of complex molecular structures.
Check Digit Verification of cas no
The CAS Registry Mumber 108847-76-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,8,4 and 7 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 108847-76:
(8*1)+(7*0)+(6*8)+(5*8)+(4*4)+(3*7)+(2*7)+(1*6)=153
153 % 10 = 3
So 108847-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H9BO2S2/c14-13(15)8-4-3-7-11-12(8)17-10-6-2-1-5-9(10)16-11/h1-7,14-15H
108847-76-3Relevant academic research and scientific papers
Thianthrene-based oligomers as hole transporting materials
Swist, Agnieszka,Soloducho, Jadwiga,Data, Przemyslaw,Lapkowski, Mieczyslaw
, p. 193 - 209 (2013/09/24)
The thianthrene-arylene conjugated units have been designed and synthesized via Suzuki or Stille coupling reaction. The structures and properties of the synthesized compounds were characterized by 1HNMR, 13CNMR, MS, UV-Vis absorption