108875-45-2 Usage
Uses
Used in Pharmaceutical Industry:
Benzyl (2-oxoazepan-3-yl)carbaMate is utilized as a pharmaceutical intermediate for the synthesis of drugs and therapeutic agents targeting a range of diseases and conditions. Its unique molecular structure allows for the development of compounds with potential applications in treating cardiovascular disorders, neurological disorders, and inflammation.
Used in Cardiovascular Applications:
In the cardiovascular field, Benzyl (2-oxoazepan-3-yl)carbaMate is used as a precursor in the development of drugs aimed at treating various heart-related conditions. Its role in the synthesis of therapeutic agents helps address the complex nature of cardiovascular diseases and their underlying mechanisms.
Used in Neurological Applications:
Benzyl (2-oxoazepan-3-yl)carbaMate is employed as a key component in the creation of pharmaceuticals for neurological disorders. Its involvement in the synthesis process contributes to the development of drugs that can potentially alleviate symptoms and improve the quality of life for patients suffering from neurological conditions.
Used in Anti-Inflammatory Applications:
In the realm of inflammation, Benzyl (2-oxoazepan-3-yl)carbaMate serves as a crucial intermediate in the synthesis of anti-inflammatory drugs. Its molecular structure enables the production of compounds that can effectively target and reduce inflammation, providing relief to individuals affected by inflammatory conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 108875-45-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,8,7 and 5 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 108875-45:
(8*1)+(7*0)+(6*8)+(5*8)+(4*7)+(3*5)+(2*4)+(1*5)=152
152 % 10 = 2
So 108875-45-2 is a valid CAS Registry Number.
InChI:InChI=1S/C14H18N2O3/c17-13-12(8-4-5-9-15-13)16-14(18)19-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2,(H,15,17)(H,16,18)
108875-45-2Relevant academic research and scientific papers
AMIDE DERIVATIVE
-
Page/Page column 113, (2009/12/05)
The present invention relates to a compound of the formula (I) being useful as a renin inhibitor, or a pharmaceutically acceptable salt thereof. wherein R1a is a hydrogen atom, an optionally substituted C1-6 alkyl, etc.; R1b is an optionally substituted C1-6 alkoxy, etc.; R1c is a hydrogen atom, an optionally substituted C1-6 alkoxy, etc.; R2 is a hydrogen atom, an optionally substituted C1-6 alkyl, etc.; R3a, R3b, R3c and R3d are independently the same or different, and each is a group of the formula: -A-B (in which A is a single bond, -(CH2)sO-, - (CH2)sN(R4)CO-, etc., B is a hydrogen atom, an optionally substituted C1-6 alkyl, etc.), etc.; R4 is a hydrogen atom, an optionally substituted C1-6 alkyl, etc.; s is 0, etc.; and n is 1, etc.
Lactam compounds and their use as inhibitors of serine proteases and method
-
Page column 33, (2010/01/30)
Lactam inhibitors are provided which have the structure X is wherein Y is O or S and R4is ?R7O— or R8 and R1, R2, R3, R5, R6, R7, and R8, are as defined herein. These compounds are inhibitors of Factor Xa and thus are useful as anticoagulants, and are inhibitors of tryptase and thus are useful in treating asthma. Methods for treating cardiovascular diseases associated with thromboses and for treating asthma and related diseases are also provided.
