108963-18-4 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
3-(DIETHYLAMINO)PYRROLIDINE is used as a building block for the synthesis of various pharmaceuticals and agrochemicals, contributing to the development of new drugs and pesticides due to its unique structural and functional properties.
Used in Catalysts for Organic Reactions:
3-(DIETHYLAMINO)PYRROLIDINE is utilized as a catalyst in various organic reactions, enhancing the efficiency and selectivity of these processes, which is crucial for the production of high-quality organic compounds.
Used in Polymer and Coating Production:
3-(DIETHYLAMINO)PYRROLIDINE is employed in the production of polymers and coatings, where its chemical properties contribute to the formation of materials with specific characteristics, such as durability and resistance to environmental factors.
Used as a Solvent in Chemical Processes:
3-(DIETHYLAMINO)PYRROLIDINE serves as a solvent in various chemical processes, facilitating reactions and improving the overall efficiency of these processes due to its solubility properties and ability to dissolve a wide range of substances.
Check Digit Verification of cas no
The CAS Registry Mumber 108963-18-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,9,6 and 3 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 108963-18:
(8*1)+(7*0)+(6*8)+(5*9)+(4*6)+(3*3)+(2*1)+(1*8)=144
144 % 10 = 4
So 108963-18-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H18N2/c1-3-10(4-2)8-5-6-9-7-8/h8-9H,3-7H2,1-2H3
