1092-47-3 Usage
Uses
Used in Pharmaceutical Industry:
1-[2-[2-[bis(isopropyl)amino]ethoxy]phenyl]butan-1-one hydrochloride is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure and functional groups enable the development of new drugs with potential therapeutic effects.
Used in Research and Development:
In the field of research, 1-[2-[2-[bis(isopropyl)amino]ethoxy]phenyl]butan-1-one hydrochloride serves as a valuable compound for studying its chemical properties, reactivity, and potential interactions with biological systems. This knowledge can be applied to design and optimize new drug candidates and materials.
Used in Organic Synthesis:
1-[2-[2-[bis(isopropyl)amino]ethoxy]phenyl]butan-1-one hydrochloride is employed as a key building block in the synthesis of complex organic molecules. Its versatile structure allows for various chemical transformations, enabling the creation of a wide range of organic compounds for different applications, such as agrochemicals, dyes, and specialty chemicals.
Used in Manufacturing:
In the manufacturing sector, 1-[2-[2-[bis(isopropyl)amino]ethoxy]phenyl]butan-1-one hydrochloride can be utilized in the production of various chemical products. Its unique properties and reactivity make it a valuable component in the synthesis of intermediates and final products for diverse industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 1092-47-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,9 and 2 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1092-47:
(6*1)+(5*0)+(4*9)+(3*2)+(2*4)+(1*7)=63
63 % 10 = 3
So 1092-47-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H29NO2.ClH/c1-6-9-17(20)16-10-7-8-11-18(16)21-13-12-19(14(2)3)15(4)5;/h7-8,10-11,14-15H,6,9,12-13H2,1-5H3;1H
