109305-66-0 Usage
Description
[(3-CHLORO-1,2,4-THIADIAZOL-5-YLTHIO)METHYL] METHYL CYANOCARBONIMIDODITHIOATE is a complex organic compound characterized by a chloro-thiadiazole ring attached to a methyl group and a cyanocarbonyl dithioate group. It is known for its high reactivity and potential toxicity if ingested or inhaled, necessitating careful handling and use under controlled conditions to protect human health and the environment.
Uses
Used in Pesticide Industry:
[(3-CHLORO-1,2,4-THIADIAZOL-5-YLTHIO)METHYL] METHYL CYANOCARBONIMIDODITHIOATE is used as an active ingredient in pesticides for its ability to control and eliminate pests. Its high reactivity contributes to its effectiveness in this application.
Used in Anti-Fungal Applications:
In the field of anti-fungal agents, [(3-CHLORO-1,2,4-THIADIAZOL-5-YLTHIO)METHYL] METHYL CYANOCARBONIMIDODITHIOATE is utilized for its potential to combat fungal infections. Its complex structure allows it to target and inhibit the growth of fungi, making it a candidate for use in various anti-fungal formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 109305-66-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,3,0 and 5 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 109305-66:
(8*1)+(7*0)+(6*9)+(5*3)+(4*0)+(3*5)+(2*6)+(1*6)=110
110 % 10 = 0
So 109305-66-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H5ClN4S4/c1-12-5(9-2-8)13-3-14-6-10-4(7)11-15-6/h3H2,1H3/b9-5+