109310-93-2 Usage
Uses
Used in Pharmaceutical Industry:
4-(3-Benzyl-thioureido)-benzoic acid is utilized as a pharmaceutical agent for its potential anti-tumor and anti-inflammatory properties. Its molecular structure allows it to interact with biological targets, making it a candidate for the development of new drugs to combat various diseases, particularly those related to tumor growth and inflammation.
Used in Drug Delivery Systems:
In the field of drug delivery, 4-(3-Benzyl-thioureido)-benzoic acid is employed to enhance the efficacy and targeted delivery of therapeutic agents. Its chemical properties can be harnessed to improve the bioavailability and distribution of drugs, potentially leading to more effective treatments with fewer side effects.
Used in Organic Synthesis:
4-(3-Benzyl-thioureido)-benzoic acid also serves as a reagent in organic synthesis, contributing to the creation of new chemical entities with potential applications in various industries, including pharmaceuticals, materials science, and agrochemicals. Its versatility in synthesis allows for the development of novel compounds with tailored properties for specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 109310-93-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,3,1 and 0 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 109310-93:
(8*1)+(7*0)+(6*9)+(5*3)+(4*1)+(3*0)+(2*9)+(1*3)=102
102 % 10 = 2
So 109310-93-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H14N2O2S/c18-14(19)12-6-8-13(9-7-12)17-15(20)16-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,18,19)(H2,16,17,20)/p-1
