109475-21-0 Usage
Description
6B,7A-Dihydro-7H-cycloprop[a]acenaphthylene-7-carboxylic acid ethyl ester is a complex carboxylic acid ester derived from the parent compound cycloprop[a]acenaphthylene. It is characterized by its unique molecular structure and chemical properties, making it a versatile compound for various applications in research and industry.
Uses
Used in Organic Chemistry Research:
6B,7A-Dihydro-7H-cycloprop[a]acenaphthylene-7-carboxylic acid ethyl ester is used as a research compound in organic chemistry for its unique structure and chemical properties. It aids in understanding the behavior of carboxylic acid esters and their interactions in various chemical reactions.
Used in Pharmaceutical Formulations:
6B,7A-Dihydro-7H-cycloprop[a]acenaphthylene-7-carboxylic acid ethyl ester is used in pharmaceutical formulations due to its potential applications in medicinal chemistry. Its unique structure and properties make it a promising candidate for the development of new drugs and therapeutic agents.
Used in Medicinal Chemistry:
6B,7A-Dihydro-7H-cycloprop[a]acenaphthylene-7-carboxylic acid ethyl ester is used as a starting material or intermediate in the synthesis of various medicinal compounds. Its ethyl ester group allows for solubility in organic solvents, making it useful in synthetic reactions and processes for drug development.
Used in Chemical Synthesis:
6B,7A-Dihydro-7H-cycloprop[a]acenaphthylene-7-carboxylic acid ethyl ester is used as a versatile building block in chemical synthesis. Its unique structure and properties enable the creation of new compounds and materials with potential applications in various industries.
Used in Solvent Systems:
6B,7A-Dihydro-7H-cycloprop[a]acenaphthylene-7-carboxylic acid ethyl ester is used in solvent systems for its solubility in organic solvents. This makes it useful in various chemical processes, including extraction, purification, and synthesis.
Overall, 6B,7A-Dihydro-7H-cycloprop[a]acenaphthylene-7-carboxylic acid ethyl ester is a valuable compound with diverse applications in research, pharmaceuticals, and industry, owing to its unique structure and chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 109475-21-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,4,7 and 5 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 109475-21:
(8*1)+(7*0)+(6*9)+(5*4)+(4*7)+(3*5)+(2*2)+(1*1)=130
130 % 10 = 0
So 109475-21-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H14O2/c1-2-18-16(17)15-13-10-7-3-5-9-6-4-8-11(12(9)10)14(13)15/h3-8,13-15H,2H2,1H3