109483-00-3 Usage
Uses
Used in Pharmaceutical Industry:
ETHYL 3-((2-METHOXY-2-OXOETHYL)THIO)PROPIONATE is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs and improve the efficacy of existing ones.
Used in Food Industry:
In the food industry, ETHYL 3-((2-METHOXY-2-OXOETHYL)THIO)PROPIONATE is used as a flavoring agent to enhance the taste and aroma of various food products, providing a unique and desirable flavor profile.
Used in Perfumery:
ETHYL 3-((2-METHOXY-2-OXOETHYL)THIO)PROPIONATE is utilized as a fragrance in perfumes, contributing to the creation of complex and long-lasting scents that appeal to consumers.
Used in Chemical Production:
As a precursor in the production of various chemicals, ETHYL 3-((2-METHOXY-2-OXOETHYL)THIO)PROPIONATE plays a crucial role in the synthesis of a wide range of chemical compounds, expanding its applications across different industries.
Used in Organic Chemistry Research:
In the field of organic chemistry, ETHYL 3-((2-METHOXY-2-OXOETHYL)THIO)PROPIONATE is employed as a reagent for the preparation of other organic compounds, facilitating the advancement of chemical research and the development of novel chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 109483-00-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,4,8 and 3 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 109483-00:
(8*1)+(7*0)+(6*9)+(5*4)+(4*8)+(3*3)+(2*0)+(1*0)=123
123 % 10 = 3
So 109483-00-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O4S/c1-3-12-7(9)4-5-13-6-8(10)11-2/h3-6H2,1-2H3
