1095085-73-6 Usage
Uses
Used in Pharmaceutical Industry:
3-(2-Ethoxyethoxy)benzonitrile is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic benefits.
Used in Agrochemical Industry:
In the agrochemical sector, 3-(2-Ethoxyethoxy)benzonitrile is utilized as a precursor in the production of agrochemicals, contributing to the development of effective pesticides and other agricultural chemicals.
Used in Dye Industry:
3-(2-Ethoxyethoxy)benzonitrile is employed as a key intermediate in the synthesis of various dyes, enabling the creation of a wide range of colorants for different applications.
Used in Polymer Production:
This chemical compound is used in the production of polymers, where its properties contribute to the development of materials with specific characteristics, such as improved strength or flexibility.
Used as a Solvent in the Semiconductor Industry:
3-(2-Ethoxyethoxy)benzonitrile is utilized as a solvent in the semiconductor industry, where its properties are beneficial for various processes, such as清洗 or etching, to enhance the performance of semiconductor devices.
Check Digit Verification of cas no
The CAS Registry Mumber 1095085-73-6 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,9,5,0,8 and 5 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1095085-73:
(9*1)+(8*0)+(7*9)+(6*5)+(5*0)+(4*8)+(3*5)+(2*7)+(1*3)=166
166 % 10 = 6
So 1095085-73-6 is a valid CAS Registry Number.
InChI:InChI=1S/C11H13NO2/c1-2-13-6-7-14-11-5-3-4-10(8-11)9-12/h3-5,8H,2,6-7H2,1H3
