109561-94-6 Usage
General Description
"(5-chloro-2-methyl-phenyl)carbamoylmethyl-(3-methoxypropyl)azanium chloride" is a chemical compound with a complex structure and a long name. It is a derivative of carbamoylmethyl and contains a chloride ion. This chemical compound likely has applications in pharmaceuticals or other industries due to its unique structure and potential reactivity. However, further research and testing would be required to determine its specific uses and potential benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 109561-94-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,5,6 and 1 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 109561-94:
(8*1)+(7*0)+(6*9)+(5*5)+(4*6)+(3*1)+(2*9)+(1*4)=136
136 % 10 = 6
So 109561-94-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H19ClN2O2.ClH/c1-10-4-5-11(14)8-12(10)16-13(17)9-15-6-3-7-18-2;/h4-5,8,15H,3,6-7,9H2,1-2H3,(H,16,17);1H
