109960-17-0 Usage
Explanation
Different sources of media describe the Explanation of 109960-17-0 differently. You can refer to the following data:
1. The compound consists of 8 carbon atoms, 9 hydrogen atoms, 1 nitrogen atom, and 2 oxygen atoms in its structure.
2. Derivative of pyrrole
2. 1H-Pyrrole-1-aceticacid,2,5-dimethyl-(9CI) is derived from the heterocyclic aromatic organic compound pyrrole.
3. Presence of acetic acid
3. The compound contains an acetic acid functional group, which contributes to its unique chemical properties.
4. Presence of dimethyl groups
4. Two methyl groups (CH3) are attached to the pyrrole ring, further modifying its chemical properties and reactivity.
5. Potential pharmaceutical applications
5. Due to its unique structure, 1H-Pyrrole-1-aceticacid,2,5-dimethyl-(9CI) could be used as a building block for synthesizing other biologically active compounds.
6. Interest in organic chemistry
6. Researchers in the field of organic chemistry may find 1H-Pyrrole-1-aceticacid,2,5-dimethyl-(9CI) useful as a reagent or intermediate for the synthesis of other organic compounds.
7. Need for further research
7. To fully understand the significance of 1H-Pyrrole-1-aceticacid,2,5-dimethyl-(9CI) in various fields, more research and exploration of its properties and potential applications are necessary.
Check Digit Verification of cas no
The CAS Registry Mumber 109960-17-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,9,6 and 0 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 109960-17:
(8*1)+(7*0)+(6*9)+(5*9)+(4*6)+(3*0)+(2*1)+(1*7)=140
140 % 10 = 0
So 109960-17-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO2/c1-6-3-4-7(2)9(6)5-8(10)11/h3-4H,5H2,1-2H3,(H,10,11)
