110219-94-8 Usage
General Description
The chemical "[(2S,3S,4R,5R,6R)-5-hydroxy-2-methyl-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[2-(4-hydroxyphenyl)ethoxy]oxan-2-yl]methoxy]-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-oxan-3-yl] 3-phenylprop-2-enoate" is a complex chemical compound consisting of a combination of sugar molecules, phenylpropenoate, and hydroxyphenyl groups. It has a complex molecular structure composed of multiple rings and hydroxyl (OH) groups, and it is derived from natural sources. This chemical compound may have potential biological or pharmaceutical applications, and its intricate structure suggests that it may have specific and targeted modes of action in physiological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 110219-94-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,2,1 and 9 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 110219-94:
(8*1)+(7*1)+(6*0)+(5*2)+(4*1)+(3*9)+(2*9)+(1*4)=78
78 % 10 = 8
So 110219-94-8 is a valid CAS Registry Number.
InChI:InChI=1/C34H44O16/c1-17-30(49-23(37)12-9-18-5-3-2-4-6-18)31(50-33-27(41)24(38)21(36)15-45-33)29(43)34(47-17)46-16-22-25(39)26(40)28(42)32(48-22)44-14-13-19-7-10-20(35)11-8-19/h2-12,17,21-22,24-36,38-43H,13-16H2,1H3/b12-9+/t17-,21+,22+,24-,25+,26-,27+,28+,29+,30-,31-,32+,33-,34+/m0/s1