110254-65-4 Usage
Chemical structure
A complex structure consisting of a chloro, nitro, and oxo functional groups attached to a dihydrobenzoquinolizine ring system.
Reactivity
Highly reactive due to the presence of electron withdrawing groups, such as the nitro group, making it a strong electrophile.
Toxicity
Potentially toxic, so caution must be exercised in handling and using 1-chloro-2-nitro-3-oxo-6,7-dihydro-3H,5H-benzo[ij]quinolizine.
Applications
May have applications in organic synthesis, pharmaceutical research, or other chemical processes due to its complex structure and reactivity.
Functional groups
Contains chloro, nitro, and oxo functional groups, which contribute to its reactivity and potential applications.
Electron withdrawing properties
The nitro group imparts significant electron withdrawing properties, enhancing the compound's electrophilic character.
Handling precautions
Due to its potential hazards, proper safety measures and handling procedures should be followed when working with 1-chloro-2-nitro-3-oxo-6,7-dihydro-3H,5H-benzo[ij]quinolizine.
Stability
The stability of the compound may be affected by factors such as temperature, light exposure, and the presence of other reactive substances.
Synthesis
The synthesis of 1-chloro-2-nitro-3-oxo-6,7-dihydro-3H,5H-benzo[ij]quinolizine may involve multiple steps and require specific reaction conditions to achieve the desired product with the correct functional groups and ring system.
Check Digit Verification of cas no
The CAS Registry Mumber 110254-65-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,2,5 and 4 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 110254-65:
(8*1)+(7*1)+(6*0)+(5*2)+(4*5)+(3*4)+(2*6)+(1*5)=74
74 % 10 = 4
So 110254-65-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H9ClN2O3/c13-9-8-5-1-3-7-4-2-6-14(10(7)8)12(16)11(9)15(17)18/h1,3,5H,2,4,6H2
110254-65-4Relevant academic research and scientific papers
Nucleophilic Substitution and Ring Closure Reactions of 4-Chloro-3-nitro-2-quinolones
Roschger, Peter,Fiala, Werner,Stadlbauer, Wolfgang
, p. 225 - 231 (2007/10/02)
4-Chloro-3-nitro-2-quinolones 3 obtained from the 4-hydroxy quinolones 1 by nitration and chlorination, reacted with sodium azide to the 4-azido derivatives 4 which cyclized on thermolysis to yield the furoxanes 5.Nucleophilic substitution reactions of 3
Methods for the Synthesis of 4-Azido-2(1H)-quinolones
Stadlbauer, Wolfgang
, p. 1305 - 1324 (2007/10/02)
4-Hydroxy-2-quinolones 1 are generally found to be converted to the 4-azidocompounds 3 via the 4-chloroquinolones 2, the 4-tosyloxyquinolones 6, or the 4-aminoquinolones 4, respectively.Choice of the reaction conditions and yields depend on the substituen