110326-09-5 Usage
Main properties
1. Chemical compound
2. Consists of a glucose molecule, uronic acid, and acetamido-2-deoxy group
3. Linked through a glycosidic bond
4. Derivative of glucuronic acid
5. Similar structure to glycosaminoglycans
Specific content
1. Glucose molecule
2. Uronic acid (specifically glucuronic acid)
3. Acetamido-2-deoxy group
4. Glycosidic bond
5. Potential biological activities in inflammation, cell proliferation, and cell adhesion
6. Applications in pharmaceutical research and development
7. Potential for treatment of various diseases and medical conditions
Check Digit Verification of cas no
The CAS Registry Mumber 110326-09-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,3,2 and 6 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 110326-09:
(8*1)+(7*1)+(6*0)+(5*3)+(4*2)+(3*6)+(2*0)+(1*9)=65
65 % 10 = 5
So 110326-09-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H21NO11/c1-5(18)15-6(3-16)12(10(21)8(20)4-17)26-14-11(22)7(19)2-9(25-14)13(23)24/h2-3,6-8,10-12,14,17,19-22H,4H2,1H3,(H,15,18)(H,23,24)/t6-,7-,8+,10+,11+,12+,14-/m0/s1