110340-32-4 Usage
General Description
The chemical "(N-(2-((4-((2-((4-(9-acridinylamino)phenyl)amino)-2-oxoethyl)amino)-4-oxobutyl)amino)-1-(1H-imidazol-4-ylmethyl)-1-oxoethyl)-6-(((-2-aminoethyl)amino)methyl)-2-pyridinecarboxamidato) iron(1+)" is a complex compound containing iron. It consists of multiple organic ligands and the metal ion iron(1+). The compound has a complex molecular structure involving acridine, phenyl, imidazole, and pyridine moieties, as well as amine and carboxamide functional groups. This complex may possess unique properties and potential applications in fields such as coordination chemistry, bioinorganic chemistry, and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 110340-32-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,3,4 and 0 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 110340-32:
(8*1)+(7*1)+(6*0)+(5*3)+(4*4)+(3*0)+(2*3)+(1*2)=54
54 % 10 = 4
So 110340-32-4 is a valid CAS Registry Number.
InChI:InChI=1/C40H43N11O4.Fe/c41-18-20-42-22-28-7-5-12-34(47-28)40(55)51-35(21-29-23-43-25-46-29)39(54)44-19-6-13-36(52)45-24-37(53)48-26-14-16-27(17-15-26)49-38-30-8-1-3-10-32(30)50-33-11-4-2-9-31(33)38;/h1-5,7-12,14-17,23,25,35,42H,6,13,18-22,24,41H2,(H,43,46)(H,44,54)(H,45,52)(H,48,53)(H,49,50)(H,51,55);/q;+2/p-1