110407-59-5 Usage
Uses
Used in Organic Synthesis:
1-Bromo-2-chloro-4-fluorobenzene is used as a synthetic intermediate for the preparation of various complex organic molecules. Its unique combination of halogen atoms allows for selective reactions and functional group transformations, making it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1-Bromo-2-chloro-4-fluorobenzene is used as a building block for the development of new drugs. Its reactivity and the ability to form diverse functional groups make it suitable for the synthesis of bioactive compounds with potential therapeutic applications.
Used in Agrochemical Industry:
1-Bromo-2-chloro-4-fluorobenzene is employed as a key intermediate in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique halogenated structure contributes to the development of effective and targeted agrochemical products.
Used in Specialty Chemicals:
In the specialty chemicals sector, 1-Bromo-2-chloro-4-fluorobenzene is utilized as a precursor for the production of various specialty chemicals, including dyes, pigments, and polymer additives. Its versatility in organic synthesis enables the creation of novel compounds with specific properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 110407-59-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,4,0 and 7 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 110407-59:
(8*1)+(7*1)+(6*0)+(5*4)+(4*0)+(3*7)+(2*5)+(1*9)=75
75 % 10 = 5
So 110407-59-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrClF/c7-5-2-1-4(9)3-6(5)8/h1-3H
