110464-98-7 Usage
Uses
Used in Chemical Synthesis:
Pyridine,2-chloro-4-methoxy-3,5-dimethylis used as an intermediate in the synthesis of various organic compounds. Its unique structure and functional groups allow it to participate in a wide range of chemical reactions, making it a valuable building block for the development of new molecules with specific properties.
Used in Pharmaceutical Industry:
Pyridine,2-chloro-4-methoxy-3,5-dimethylis used as a key component in the development of pharmaceuticals. Its ability to interact with other molecules and its potential reactivity make it a promising candidate for the creation of new drugs with specific therapeutic effects.
Used in Agrochemical Industry:
Pyridine,2-chloro-4-methoxy-3,5-dimethylis used as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique properties and reactivity contribute to the development of effective and targeted agrochemicals for crop protection and management.
Used in Dye and Pigment Industry:
Pyridine,2-chloro-4-methoxy-3,5-dimethylis used as a starting material for the production of dyes and pigments. Its ability to form stable complexes with other molecules allows for the creation of vibrant and stable colorants for various applications, including textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 110464-98-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,4,6 and 4 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 110464-98:
(8*1)+(7*1)+(6*0)+(5*4)+(4*6)+(3*4)+(2*9)+(1*8)=97
97 % 10 = 7
So 110464-98-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H10ClNO/c1-5-4-10-8(9)6(2)7(5)11-3/h4H,1-3H3
