111106-29-7 Usage
General Description
(+-)-3-((3,4-Dichlorobenzoyl)amino)-4-((3-methoxypropyl)pentylamino)-4 -oxobutanoic acid is a chemical compound with a complex structure that consists of a 3,4-Dichlorobenzoyl group, a 3-methoxypropyl pentylamino group, and a 4-oxobutanoic acid group. (+-)-3-((3,4-Dichlorobenzoyl)amino)-4-((3-methoxypropyl)pentylamino)-4 -oxobutanoic acid is classified as a potent and selective cannabinoid receptor (CB1) antagonist, making it potentially useful in the development of medications for conditions such as obesity and metabolic disorders. Additionally, it has shown promising effects in the treatment of drug addiction and withdrawal symptoms. The complexity and specific structure of this compound make it a significant target for further research and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 111106-29-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,1,0 and 6 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 111106-29:
(8*1)+(7*1)+(6*1)+(5*1)+(4*0)+(3*6)+(2*2)+(1*9)=57
57 % 10 = 7
So 111106-29-7 is a valid CAS Registry Number.
InChI:InChI=1/C20H28Cl2N2O5/c1-3-4-5-9-24(10-6-11-29-2)20(28)17(13-18(25)26)23-19(27)14-7-8-15(21)16(22)12-14/h7-8,12,17H,3-6,9-11,13H2,1-2H3,(H,23,27)(H,25,26)