111130-14-4 Usage
Molecular weight
441.24 g/mol
Structure
Contains a tetrazole ring (five-membered ring with four nitrogen atoms and one carbon atom) and a carboxamide group (-CONH~2~) attached to a substituted phenyl group.
+ 5-(3-(4-Acetyl-3-hydroxy-2-propylphenoxy)propoxy) group
a propylphenoxide chain with an acetyl (-COCH~3~) and a hydroxyl (-OH) functional group attached to the phenyl ring.
+ 4-Bromo-2-methylphenyl group
a phenyl ring with a bromine atom (-Br) at the 4-position and a methyl group (-CH~3~) at the 2-position.
+ Appearance
White or off-white crystalline solid
+ Solubility
Soluble in water, methanol, and ethanol
+ Stability
Stable under normal temperature and pressure, but may decompose upon exposure to heat or light.
Potential applications
Pharmaceutical, agrochemical, or other industrial uses (e.g., as a precursor for synthesis of other compounds)
Handling precautions
Handle with care due to potential hazards and reactivity. Use appropriate personal protective equipment and follow safety guidelines for chemical handling.
Check Digit Verification of cas no
The CAS Registry Mumber 111130-14-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,1,3 and 0 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 111130-14:
(8*1)+(7*1)+(6*1)+(5*1)+(4*3)+(3*0)+(2*1)+(1*4)=44
44 % 10 = 4
So 111130-14-4 is a valid CAS Registry Number.
InChI:InChI=1/C23H26BrN5O5.Na/c1-4-6-16-19(8-7-15(14(3)30)21(16)31)33-9-5-10-34-20-12-18(13(2)11-17(20)24)25-23(32)22-26-28-29-27-22;/h7-8,11-12,25,31-32H,4-6,9-10H2,1-3H3;/q;+1/p-1