111218-89-4 Usage
Uses
Used in Pharmaceutical Synthesis:
6-Bromo-2-chloroquinazolin-4-amine is utilized as a key intermediate in the synthesis of various pharmaceuticals, particularly for the development of drugs targeting specific enzymes and proteins. Its unique structure and functional groups contribute to the design of novel therapeutic agents with improved efficacy and selectivity.
Used in Agrochemical Development:
In the agrochemical industry, 6-Bromo-2-chloroquinazolin-4-amine serves as a crucial component in the creation of new pesticides and herbicides. Its ability to inhibit certain biological targets makes it a promising candidate for the development of more effective and environmentally friendly crop protection products.
Used in Research and Development:
6-Bromo-2-chloroquinazolin-4-amine is employed as a versatile building block in organic synthesis for research purposes. It is used to explore new chemical reactions and pathways, leading to the discovery of innovative compounds with potential applications in various fields, including medicine, materials science, and environmental chemistry.
Used in Biochemical Applications:
Due to its potential as an enzyme and protein inhibitor, 6-Bromo-2-chloroquinazolin-4-amine is applied in biochemical research to study the mechanisms of action and interactions with biological targets. This knowledge can be instrumental in the development of targeted therapies and understanding the molecular basis of diseases.
Used in Organic Synthesis:
6-Bromo-2-chloroquinazolin-4-amine is a valuable precursor in organic synthesis, allowing for the functionalization and modification of its structure to create new chemical compounds with diverse properties. This versatility makes it an essential tool for chemists in the design and synthesis of novel molecules for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 111218-89-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,2,1 and 8 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 111218-89:
(8*1)+(7*1)+(6*1)+(5*2)+(4*1)+(3*8)+(2*8)+(1*9)=84
84 % 10 = 4
So 111218-89-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H5BrClN3/c9-4-1-2-6-5(3-4)7(11)13-8(10)12-6/h1-3H,(H2,11,12,13)
111218-89-4Relevant academic research and scientific papers
BETA-ADRENERGIC RECEPTOR ALLOSTERIC MODULATORS
-
Paragraph 0337, (2019/11/12)
Provided herein are modulators of beta-adrenergic receptors.
