111252-36-9 Usage
Uses
Used in Pharmaceutical Synthesis:
(E)-3-(5-Acetyl-furan-2-yl)acrylic acid is used as an intermediate in the synthesis of pharmaceuticals and organic compounds. Its unique structure allows it to be a valuable building block for the development of new drugs with various therapeutic properties.
Used in Flavor and Fragrance Production:
In the flavor and fragrance industry, (E)-3-(5-Acetyl-furan-2-yl)acrylic acid is utilized in the production of various scents and tastes. Its distinct chemical composition contributes to the creation of unique and desirable sensory experiences in consumer products.
Used in Chemical Research:
(E)-3-(5-Acetyl-furan-2-yl)acrylic acid is also used as a chemical building block for the preparation of various derivatives with different properties and applications. This makes it a valuable tool in chemical research, enabling the exploration of new compounds and their potential uses across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 111252-36-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,2,5 and 2 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 111252-36:
(8*1)+(7*1)+(6*1)+(5*2)+(4*5)+(3*2)+(2*3)+(1*6)=69
69 % 10 = 9
So 111252-36-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H8O4/c1-6(10)8-4-2-7(13-8)3-5-9(11)12/h2-5H,1H3,(H,11,12)/b5-3+
