111385-66-1 Usage
General Description
2-(2,3,4,5,6-Pentamethylbenzoyl)benzoic acid is a chemical compound with the molecular formula C21H22O3. It is a derivative of benzoic acid and is commonly used in the field of organic chemistry as a reagent and building block for synthesizing various other compounds. This chemical is known for its high stability and is often used in the production of pharmaceuticals, dyes, and other organic substances. Its unique structure and properties make it a valuable tool in the synthesis of complex organic molecules, and it is often utilized in the research and development of new materials and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 111385-66-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,3,8 and 5 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 111385-66:
(8*1)+(7*1)+(6*1)+(5*3)+(4*8)+(3*5)+(2*6)+(1*6)=101
101 % 10 = 1
So 111385-66-1 is a valid CAS Registry Number.
InChI:InChI=1/C19H20O3/c1-10-11(2)13(4)17(14(5)12(10)3)18(20)15-8-6-7-9-16(15)19(21)22/h6-9H,1-5H3,(H,21,22)