111682-13-4 Usage
Description
MEOSUC-ALA-ALA-PRO-ALA-CHLOROMETHYLKETONE is a tripeptide derived from methoxysuccinyl-Ala-Ala-Pro-Ala, with the terminal carboxy group converted to the corresponding chloromethyl ketone. This modification enhances its chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
MEOSUC-ALA-ALA-PRO-ALA-CHLOROMETHYLKETONE is used as a pharmaceutical candidate for its unique chemical structure and potential therapeutic effects. The chloromethyl ketone group allows for targeted drug delivery and increased bioavailability, making it a promising agent for the development of novel medications.
Used in Drug Delivery Systems:
In the field of drug delivery, MEOSUC-ALA-ALA-PRO-ALA-CHLOROMETHYLKETONE serves as a carrier molecule for various therapeutic agents. Its ability to form covalent bonds with target molecules enables the development of site-specific drug delivery systems, improving the efficacy and reducing the side effects of treatments.
Used in Chemical Synthesis:
MEOSUC-ALA-ALA-PRO-ALA-CHLOROMETHYLKETONE is also utilized in chemical synthesis as a building block for the creation of more complex molecules. Its unique structure allows for the development of new compounds with potential applications in various industries, including pharmaceuticals, materials science, and biotechnology.
Check Digit Verification of cas no
The CAS Registry Mumber 111682-13-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,6,8 and 2 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 111682-13:
(8*1)+(7*1)+(6*1)+(5*6)+(4*8)+(3*2)+(2*1)+(1*3)=94
94 % 10 = 4
So 111682-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H31ClN4O7/c1-11(22-16(27)7-8-17(28)32-4)18(29)23-12(2)19(30)24-20(31)14-6-5-9-25(14)13(3)15(26)10-21/h11-14H,5-10H2,1-4H3,(H,22,27)(H,23,29)(H,24,30,31)/t11-,12-,13-,14-/m0/s1