111760-38-4 Usage
Description
2-Thiophen-3-yl-piperazine, also known as T3P, is a chemical compound characterized by a piperazine ring with a thiophene group attached to the third carbon atom. It serves as a versatile intermediate in the synthesis of pharmaceuticals and agrochemicals, enabling the preparation of various biologically active compounds. T3P has demonstrated potential antimicrobial, antifungal, and anticancer properties, making it a promising candidate for the development of novel drug molecules. Furthermore, its applications extend to materials science, particularly in the synthesis of conductive polymers and organic light-emitting diodes.
Uses
Used in Pharmaceutical and Agrochemical Industries:
2-Thiophen-3-yl-piperazine is used as a chemical intermediate for the synthesis of various biologically active compounds, contributing to the development of new pharmaceuticals and agrochemicals.
Used in Antimicrobial Applications:
2-Thiophen-3-yl-piperazine is used as an antimicrobial agent, exhibiting potential activity against a range of microorganisms, thereby contributing to the development of novel antimicrobial drugs.
Used in Antifungal Applications:
2-Thiophen-3-yl-piperazine is used as an antifungal agent, showing promise in the treatment of fungal infections and the development of new antifungal medications.
Used in Anticancer Applications:
2-Thiophen-3-yl-piperazine is used as an anticancer agent, with potential activity against various types of cancer, making it a candidate for the development of innovative cancer therapies.
Used in Materials Science:
2-Thiophen-3-yl-piperazine is used in the synthesis of conductive polymers and organic light-emitting diodes, contributing to advancements in electronic and optoelectronic materials.
Overall, 2-Thiophen-3-yl-piperazine has a diverse range of potential applications across various industries, including pharmaceuticals, agrochemicals, antimicrobial, antifungal, anticancer, and materials science, making it a valuable compound for ongoing research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 111760-38-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,7,6 and 0 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 111760-38:
(8*1)+(7*1)+(6*1)+(5*7)+(4*6)+(3*0)+(2*3)+(1*8)=94
94 % 10 = 4
So 111760-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N2S/c1-4-11-6-7(1)8-5-9-2-3-10-8/h1,4,6,8-10H,2-3,5H2