111844-33-8 Usage
General Description
The chemical "(5S,6R)-6-[(2R)-2-amino-2-carboxy-ethyl]sulfanyl-5,20-dihydroxy-icosa-7,9,11,14-tetraenoic acid" is a compound with a complex structure that includes a tetraenoic acid core. It contains a sulfanyl group and two hydroxy groups at specific positions on the hydrocarbon chain. Additionally, it has an amino and a carboxy-ethyl functional group attached to the molecule. This chemical likely has biological importance, as it contains an amino acid-like structure and multiple hydroxy groups, which are common features in bioactive compounds. The stereochemistry of the molecule is designated as (5S,6R) and (2R), indicating the specific orientation of the functional groups within the molecule. (5S,6R)-6-[(2R)-2-amino-2-carboxy-ethyl]sulfanyl-5,20-dihydroxy-icosa-7,9,11,14-tetraenoic acid may have potential applications in pharmaceuticals, biochemistry, or other fields related to organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 111844-33-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,8,4 and 4 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 111844-33:
(8*1)+(7*1)+(6*1)+(5*8)+(4*4)+(3*4)+(2*3)+(1*3)=98
98 % 10 = 8
So 111844-33-8 is a valid CAS Registry Number.
InChI:InChI=1/C23H37NO6S/c24-19(23(29)30)18-31-21(20(26)14-13-16-22(27)28)15-11-9-7-5-3-1-2-4-6-8-10-12-17-25/h2-5,7,9,11,15,19-21,25-26H,1,6,8,10,12-14,16-18,24H2,(H,27,28)(H,29,30)/b4-2-,5-3-,9-7+,15-11+/t19-,20-,21+/m0/s1