112055-80-8 Usage
Description
Alpha-Amino-2-carboxy-4-pyridinepropanoic acid, also known as D-(+)-2-Aminomuconic acid or E-4-(2-Aminovinyl)-2-Pyridencarboxylic acid, is an organic compound belonging to the class of N-arylmethylamines. These compounds contain an arylamine substituted by one alkyl group through a nitrogen atom. Primarily used in scientific or industrial settings, alpha-Amino-2-carboxy-4-pyridinepropanoic acid plays a role in numerous chemical reactions. It is typically a solid, pale yellow or white, and is represented by the molecular formula C9H9NO4. Safety measures are necessary when handling this compound, as it is slightly hazardous in case of skin contact, ingestion, or inhalation.
Uses
Used in Chemical Reactions:
Alpha-Amino-2-carboxy-4-pyridinepropanoic acid is used as a reactant in various chemical reactions due to its unique structure and properties. Its ability to participate in reactions involving arylamines and alkyl groups makes it a valuable component in the synthesis of various organic compounds.
Used in Scientific Research:
In the field of scientific research, alpha-Amino-2-carboxy-4-pyridinepropanoic acid is utilized as a research compound to study its properties, reactions, and potential applications. Researchers can use this compound to explore its behavior in different chemical environments and investigate its potential uses in various industries.
Used in Industrial Applications:
In industrial settings, alpha-Amino-2-carboxy-4-pyridinepropanoic acid is employed as a key component in the production of various chemicals and materials. Its versatility in chemical reactions allows it to be used in the synthesis of a wide range of products, contributing to the development of new technologies and innovations.
Check Digit Verification of cas no
The CAS Registry Mumber 112055-80-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,0,5 and 5 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 112055-80:
(8*1)+(7*1)+(6*2)+(5*0)+(4*5)+(3*5)+(2*8)+(1*0)=78
78 % 10 = 8
So 112055-80-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O4/c10-6(8(12)13)3-5-1-2-11-7(4-5)9(14)15/h1-2,4,6H,3,10H2,(H,12,13)(H,14,15)/t6-/m0/s1
112055-80-8Relevant articles and documents
Synthese von 3-(2-Carboxy-4-pyridyl)- und 3-(6-Carboxy-3-pyridyl)-DL-alanin
Hilpert, Hans
, p. 1307 - 1311 (1987)
As starting materials for potential photochemical approaches to betaines C (R = COOH) and to muscaflavine F (R = COOH), β-(2-carboxy-4-pyridyl)-DL-alanine (A and D with R = COOH or 4 and 11), respectively, were prepared (Scheme 1).The synthesis of 4 (=A, R = COOH) started with the 2-malonate 1 and proceeded via the N-oxide 2, cyanation and hydrolysis (Scheme 2).Amino acid 11 was obtained from (3-pyridyl)methyl bromide (6) via the malonate 7 by an analogous sequence of reactions (Scheme 3).
