112055-80-8 Usage
Uses
Used in Chemical Reactions:
Alpha-Amino-2-carboxy-4-pyridinepropanoic acid is used as a reactant in various chemical reactions due to its unique structure and properties. Its ability to participate in reactions involving arylamines and alkyl groups makes it a valuable component in the synthesis of various organic compounds.
Used in Scientific Research:
In the field of scientific research, alpha-Amino-2-carboxy-4-pyridinepropanoic acid is utilized as a research compound to study its properties, reactions, and potential applications. Researchers can use alpha-Amino-2-carboxy-4-pyridinepropanoic acid to explore its behavior in different chemical environments and investigate its potential uses in various industries.
Used in Industrial Applications:
In industrial settings, alpha-Amino-2-carboxy-4-pyridinepropanoic acid is employed as a key component in the production of various chemicals and materials. Its versatility in chemical reactions allows it to be used in the synthesis of a wide range of products, contributing to the development of new technologies and innovations.
Check Digit Verification of cas no
The CAS Registry Mumber 112055-80-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,0,5 and 5 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 112055-80:
(8*1)+(7*1)+(6*2)+(5*0)+(4*5)+(3*5)+(2*8)+(1*0)=78
78 % 10 = 8
So 112055-80-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O4/c10-6(8(12)13)3-5-1-2-11-7(4-5)9(14)15/h1-2,4,6H,3,10H2,(H,12,13)(H,14,15)/t6-/m0/s1
112055-80-8Relevant academic research and scientific papers
Hilpert, Hans
, p. 1307 - 1311 (1987)
As starting materials for potential photochemical approaches to betaines C (R = COOH) and to muscaflavine F (R = COOH), β-(2-carboxy-4-pyridyl)-DL-alanine (A and D with R = COOH or 4 and 11), respectively, were prepared (Scheme 1).The synthesis of 4 (=A, R = COOH) started with the 2-malonate 1 and proceeded via the N-oxide 2, cyanation and hydrolysis (Scheme 2).Amino acid 11 was obtained from (3-pyridyl)methyl bromide (6) via the malonate 7 by an analogous sequence of reactions (Scheme 3).
