1122090-95-2 Usage
Uses
Used in Pharmaceutical Industry:
2,5-Dichloro-4-Methoxypyridine is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows it to be a key component in the development of new drugs and medications, enhancing their efficacy and therapeutic properties.
Used in Chemical Synthesis:
2,5-Dichloro-4-Methoxypyridine is used as a building block in the synthesis of complex organic chemicals. Its organo-chlorine nature and aromatic ether properties make it a versatile compound for creating a wide range of chemical products, from agrochemicals to specialty chemicals.
Used in Organochlorine Pesticide Industry:
As an organochlorine pesticide, 2,5-Dichloro-4-Methoxypyridine contributes to the development of effective and long-lasting pest control solutions. Its chemical properties enable it to target and eliminate various pests, protecting crops and ensuring food security.
Check Digit Verification of cas no
The CAS Registry Mumber 1122090-95-2 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,2,2,0,9 and 0 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1122090-95:
(9*1)+(8*1)+(7*2)+(6*2)+(5*0)+(4*9)+(3*0)+(2*9)+(1*5)=102
102 % 10 = 2
So 1122090-95-2 is a valid CAS Registry Number.
InChI:InChI=1S/C6H5Cl2NO/c1-10-5-2-6(8)9-3-4(5)7/h2-3H,1H3
1122090-95-2Relevant academic research and scientific papers
PYRIDINE DERIVATIVES AS S1P1/EDG1 RECEPTOR MODULATORS
-
Page/Page column 28, (2011/09/20)
The invention relates to novel pyridine derivatives of formula (D, their preparation and their use as pharmaceutically active compounds. Said compounds particularly act as immunomodulating agents. Formula (I) wherein A represents and the other substituents are as defined in the claims.
PYRIDINE DERIVATIVES AS S1P1/EDG1 RECEPTOR MODULATORS
-
Page/Page column 78-79, (2009/04/25)
The invention relates to novel pyridine derivatives of formula (D, their preparation and their use as pharmaceutically active compounds. Said compounds particularly act as immunomodulating agents. Formula (I) wherein A represents and the other substituants are as defined in the claims.
