112230-20-3 Usage
Uses
Used in Pharmaceutical Industry:
2-(CHLOROMETHYL)IMIDAZO[1,2-A]PYRIDINE HYDROCHLORIDE is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and reactivity make it a valuable building block in the development of new drugs with potential therapeutic applications.
Used in Chemical Research:
2-(CHLOROMETHYL)IMIDAZO[1,2-A]PYRIDINE HYDROCHLORIDE is used as a research compound in the field of organic chemistry. It serves as a model for studying the properties and reactions of imidazo[1,2-a]pyridine derivatives, contributing to the understanding of their chemical behavior and potential applications in various industries.
Used in Material Science:
2-(CHLOROMETHYL)IMIDAZO[1,2-A]PYRIDINE HYDROCHLORIDE is used as a precursor in the synthesis of advanced materials, such as polymers and composites, that exhibit unique properties. Its incorporation into these materials can lead to the development of new products with improved performance characteristics in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 112230-20-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,2,3 and 0 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 112230-20:
(8*1)+(7*1)+(6*2)+(5*2)+(4*3)+(3*0)+(2*2)+(1*0)=53
53 % 10 = 3
So 112230-20-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H7ClN2.ClH/c9-5-7-6-11-4-2-1-3-8(11)10-7;/h1-4,6H,5H2;1H
