1124369-40-9 Usage
Uses
Used in Organic Chemistry Research:
(S)-Pyrrolidine-3-carboxylic acid hydrochloride serves as a valuable compound in organic chemistry research, where it is employed as a building block or intermediate for the synthesis of various complex organic molecules. Its unique structure and reactivity make it suitable for the development of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (S)-pyrrolidine-3-carboxylic acid hydrochloride is used as a chiral synthon for the production of enantiomerically pure drugs. Its specific spatial arrangement allows for the creation of single-enantiomer pharmaceuticals, which can exhibit different biological activities and reduce potential side effects associated with racemic mixtures.
Used in Chiral Catalysts:
(S)-Pyrrolidine-3-carboxylic acid hydrochloride can also be utilized as a chiral catalyst in asymmetric synthesis, a technique that allows for the selective formation of one enantiomer over another. This application is crucial in the production of enantiomerically pure compounds, which are often required for biological activity and to meet regulatory standards in the pharmaceutical and agrochemical industries.
Used in Analytical Chemistry:
In analytical chemistry, (S)-pyrrolidine-3-carboxylic acid hydrochloride can be employed as a chiral derivatizing agent for the resolution and analysis of enantiomers. Its ability to selectively react with specific enantiomers can help in the separation and identification of chiral compounds using techniques such as chromatography and mass spectrometry.
Overall, (S)-pyrrolidine-3-carboxylic acid hydrochloride is a versatile compound with applications spanning across various fields of chemistry, including organic synthesis, pharmaceutical development, chiral catalysis, and analytical chemistry. Its unique properties and reactivity make it an essential tool for researchers and industry professionals alike.
Check Digit Verification of cas no
The CAS Registry Mumber 1124369-40-9 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,2,4,3,6 and 9 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1124369-40:
(9*1)+(8*1)+(7*2)+(6*4)+(5*3)+(4*6)+(3*9)+(2*4)+(1*0)=129
129 % 10 = 9
So 1124369-40-9 is a valid CAS Registry Number.
InChI:InChI=1S/C5H9NO2.ClH/c7-5(8)4-1-2-6-3-4;/h4,6H,1-3H2,(H,7,8);1H/t4-;/m0./s1
1124369-40-9Relevant academic research and scientific papers
PYRROLIDINE DERIVATIVES AS HISTAMINE RECEPTORS LIGANDS
-
Page/Page column 23, (2010/11/08)
The present invention relates to pyrrolidine derivatives of formula (I) having pharmacological activity, processes for their preparation, to compositions containing them and to their use in the treatment of neurological and psychiatric disorders.
