1125-66-2 Usage
Description
4-CHLORO-3-ETHYL-5-METHYLPHENOL is a phenol derivative characterized by the substitution of a chlorine atom at the 4th position, an ethyl group at the 3rd position, and a methyl group at the 5th position of the phenol molecule. This chemical compound possesses antimicrobial and antiseptic properties, making it a valuable ingredient in various applications.
Uses
Used in Personal Care and Hygiene Products:
4-CHLORO-3-ETHYL-5-METHYLPHENOL is used as an antimicrobial and antiseptic agent for its effectiveness in inhibiting the growth of microorganisms. This property makes it a common ingredient in soaps, detergents, and other cosmetic products, ensuring cleanliness and reducing the risk of infections.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-CHLORO-3-ETHYL-5-METHYLPHENOL is utilized in the treatment of resistant bacterial infections. Its ability to combat drug-resistant bacteria highlights its importance as a compound in developing new antibiotics and therapeutic agents.
Used in Antimicrobial Applications:
4-CHLORO-3-ETHYL-5-METHYLPHENOL is employed as an antimicrobial agent due to its ability to inhibit microbial growth. This makes it suitable for use in various settings where preventing the spread of infections is crucial, such as in hospitals, food processing facilities, and other environments where hygiene is paramount.
Check Digit Verification of cas no
The CAS Registry Mumber 1125-66-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,2 and 5 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1125-66:
(6*1)+(5*1)+(4*2)+(3*5)+(2*6)+(1*6)=52
52 % 10 = 2
So 1125-66-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H11ClO/c1-3-7-5-8(11)4-6(2)9(7)10/h4-5,11H,3H2,1-2H3
